C12H17F2N3O3S — CID 118760689
[1-[1-(difluoromethyl)-5-methylpyrrole-2-carbonyl]pyrrolidin-3-yl]methanesulfonamide (PubChem CID 118760689) has the molecular formula C12H17F2N3O3S and a molecular weight of 321.35 g/mol. Its IUPAC name is [1-[1-(difluoromethyl)-5-methylpyrrole-2-carbonyl]pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-[1-(difluoromethyl)-5-methylpyrrole-2-carbonyl]pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 118760689 |
| Molecular Formula | C12H17F2N3O3S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | [1-[1-(difluoromethyl)-5-methylpyrrole-2-carbonyl]pyrrolidin-3-yl]methanesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCC(CS(N)(=O)=O)C2)n1C(F)F |
| InChI | InChI=1S/C12H17F2N3O3S/c1-8-2-3-10(17(8)12(13)14)11(18)16-5-4-9(6-16)7-21(15,19)20/h2-3,9,12H,4-7H2,1H3,(H2,15,19,20) |
| InChIKey | IAFCSFMAAPBXHJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |