C20H26N4OS — CID 118761100
3-benzylsulfanyl-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propan-1-one (PubChem CID 118761100) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-benzylsulfanyl-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 118761100 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 3-benzylsulfanyl-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1ncnc(N2CCN(C(=O)CCSCc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C20H26N4OS/c1-16-17(2)21-15-22-20(16)24-11-9-23(10-12-24)19(25)8-13-26-14-18-6-4-3-5-7-18/h3-7,15H,8-14H2,1-2H3 |
| InChIKey | GJONXTCFEFPDST-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|