C20H24N2OS — CID 91839545
3-benzylsulfanyl-1-(4-pyridin-4-ylpiperidin-1-yl)propan-1-one (PubChem CID 91839545) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-(4-pyridin-4-ylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-benzylsulfanyl-1-(4-pyridin-4-ylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 91839545 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-benzylsulfanyl-1-(4-pyridin-4-ylpiperidin-1-yl)propan-1-one |
| SMILES | O=C(CCSCc1ccccc1)N1CCC(c2ccncc2)CC1 |
| InChI | InChI=1S/C20H24N2OS/c23-20(10-15-24-16-17-4-2-1-3-5-17)22-13-8-19(9-14-22)18-6-11-21-12-7-18/h1-7,11-12,19H,8-10,13-16H2 |
| InChIKey | RQQNPPBLOYDFCX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|