C22H27NO2S — CID 97201109
3-benzylsulfanyl-1-[(3S)-3-[[4-(hydroxymethyl)phenyl]methyl]pyrrolidin-1-yl]propan-1-one (PubChem CID 97201109) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-[(3S)-3-[[4-(hydroxymethyl)phenyl]methyl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-benzylsulfanyl-1-[(3S)-3-[[4-(hydroxymethyl)phenyl]methyl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 97201109 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-benzylsulfanyl-1-[(3S)-3-[[4-(hydroxymethyl)phenyl]methyl]pyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(CCSCc1ccccc1)N1CC[C@H](Cc2ccc(CO)cc2)C1 |
| InChI | InChI=1S/C22H27NO2S/c24-16-19-8-6-18(7-9-19)14-21-10-12-23(15-21)22(25)11-13-26-17-20-4-2-1-3-5-20/h1-9,21,24H,10-17H2/t21-/m1/s1 |
| InChIKey | UEYCRDVGKWJNHR-OAQYLSRUSA-N |
| XLogP | 3.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|