C21H24N2O2S — CID 91831465
3-benzylsulfanyl-1-[3-(pyridine-2-carbonyl)piperidin-1-yl]propan-1-one (PubChem CID 91831465) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-[3-(pyridine-2-carbonyl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-benzylsulfanyl-1-[3-(pyridine-2-carbonyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 91831465 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-benzylsulfanyl-1-[3-(pyridine-2-carbonyl)piperidin-1-yl]propan-1-one |
| SMILES | O=C(c1ccccn1)C1CCCN(C(=O)CCSCc2ccccc2)C1 |
| InChI | InChI=1S/C21H24N2O2S/c24-20(11-14-26-16-17-7-2-1-3-8-17)23-13-6-9-18(15-23)21(25)19-10-4-5-12-22-19/h1-5,7-8,10,12,18H,6,9,11,13-16H2 |
| InChIKey | SOASUAGQOPZZLX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|