C16H18N4O4 — CID 77088791
3-[2-oxo-2-[3-(pyridine-2-carbonyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 77088791) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-[2-oxo-2-[3-(pyridine-2-carbonyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-oxo-2-[3-(pyridine-2-carbonyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 77088791 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-[2-oxo-2-[3-(pyridine-2-carbonyl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C(c1ccccn1)C1CCCN(C(=O)CN2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C16H18N4O4/c21-13-8-18-16(24)20(13)10-14(22)19-7-3-4-11(9-19)15(23)12-5-1-2-6-17-12/h1-2,5-6,11H,3-4,7-10H2,(H,18,24) |
| InChIKey | BZZXEHIJJSQFMQ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|