C20H24N2O3 — CID 118761816
3-(4-hydroxy-3,5-dimethylphenyl)-N-[4-(methylamino)-4-oxobutyl]benzamide (PubChem CID 118761816) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethylphenyl)-N-[4-(methylamino)-4-oxobutyl]benzamide.
| Compound Name | 3-(4-hydroxy-3,5-dimethylphenyl)-N-[4-(methylamino)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 118761816 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethylphenyl)-N-[4-(methylamino)-4-oxobutyl]benzamide |
| SMILES | CNC(=O)CCCNC(=O)c1cccc(-c2cc(C)c(O)c(C)c2)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-13-10-17(11-14(2)19(13)24)15-6-4-7-16(12-15)20(25)22-9-5-8-18(23)21-3/h4,6-7,10-12,24H,5,8-9H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | UJTMUMWCRFJRBS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|