C20H23NO2 — CID 53250516
3-[(E)-2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]-N-propylbenzamide (PubChem CID 53250516) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-[(E)-2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]-N-propylbenzamide.
| Compound Name | 3-[(E)-2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 53250516 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-[(E)-2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cccc(/C=C/c2cc(C)c(O)c(C)c2)c1 |
| InChI | InChI=1S/C20H23NO2/c1-4-10-21-20(23)18-7-5-6-16(13-18)8-9-17-11-14(2)19(22)15(3)12-17/h5-9,11-13,22H,4,10H2,1-3H3,(H,21,23)/b9-8+ |
| InChIKey | JGEQYRNNIKTPPQ-CMDGGOBGSA-N |
| XLogP | 4.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|