C19H28N4O2S — CID 118762293
N-[3-[2-(methylamino)-2-oxoethyl]phenyl]-4-thiomorpholin-4-ylpiperidine-1-carboxamide (PubChem CID 118762293) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is N-[3-[2-(methylamino)-2-oxoethyl]phenyl]-4-thiomorpholin-4-ylpiperidine-1-carboxamide.
| Compound Name | N-[3-[2-(methylamino)-2-oxoethyl]phenyl]-4-thiomorpholin-4-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 118762293 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[3-[2-(methylamino)-2-oxoethyl]phenyl]-4-thiomorpholin-4-ylpiperidine-1-carboxamide |
| SMILES | CNC(=O)Cc1cccc(NC(=O)N2CCC(N3CCSCC3)CC2)c1 |
| InChI | InChI=1S/C19H28N4O2S/c1-20-18(24)14-15-3-2-4-16(13-15)21-19(25)23-7-5-17(6-8-23)22-9-11-26-12-10-22/h2-4,13,17H,5-12,14H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | PAPHVBLYOHSTIB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |