C17H23N3OS — CID 98349166
(3R)-3-(2,5-dihydropyrrol-1-yl)-N-[3-(methylsulfanylmethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 98349166) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is (3R)-3-(2,5-dihydropyrrol-1-yl)-N-[3-(methylsulfanylmethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-(2,5-dihydropyrrol-1-yl)-N-[3-(methylsulfanylmethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 98349166 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (3R)-3-(2,5-dihydropyrrol-1-yl)-N-[3-(methylsulfanylmethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | CSCc1cccc(NC(=O)N2CC[C@@H](N3CC=CC3)C2)c1 |
| InChI | InChI=1S/C17H23N3OS/c1-22-13-14-5-4-6-15(11-14)18-17(21)20-10-7-16(12-20)19-8-2-3-9-19/h2-6,11,16H,7-10,12-13H2,1H3,(H,18,21)/t16-/m1/s1 |
| InChIKey | GMJSVWROFBAOKE-MRXNPFEDSA-N |
| XLogP | 3.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|