C17H21ClN4O2 — CID 71870359
N-(3-acetamido-4-chlorophenyl)-3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide (PubChem CID 71870359) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-(3-acetamido-4-chlorophenyl)-3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3-acetamido-4-chlorophenyl)-3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71870359 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(3-acetamido-4-chlorophenyl)-3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide |
| SMILES | CC(=O)Nc1cc(NC(=O)N2CCC(N3CC=CC3)C2)ccc1Cl |
| InChI | InChI=1S/C17H21ClN4O2/c1-12(23)19-16-10-13(4-5-15(16)18)20-17(24)22-9-6-14(11-22)21-7-2-3-8-21/h2-5,10,14H,6-9,11H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | DOQMDKCIKFIEEK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|