C18H26N4O2 — CID 98349135
(3S)-3-(2,5-dihydropyrrol-1-yl)-N-[6-(2-methylpropoxy)-3-pyridinyl]pyrrolidine-1-carboxamide (PubChem CID 98349135) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3S)-3-(2,5-dihydropyrrol-1-yl)-N-[6-(2-methylpropoxy)-3-pyridinyl]pyrrolidine-1-carboxamide.
| Compound Name | (3S)-3-(2,5-dihydropyrrol-1-yl)-N-[6-(2-methylpropoxy)-3-pyridinyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 98349135 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (3S)-3-(2,5-dihydropyrrol-1-yl)-N-[6-(2-methylpropoxy)-3-pyridinyl]pyrrolidine-1-carboxamide |
| SMILES | CC(C)COc1ccc(NC(=O)N2CC[C@H](N3CC=CC3)C2)cn1 |
| InChI | InChI=1S/C18H26N4O2/c1-14(2)13-24-17-6-5-15(11-19-17)20-18(23)22-10-7-16(12-22)21-8-3-4-9-21/h3-6,11,14,16H,7-10,12-13H2,1-2H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | CETJYRWIYLJYFX-INIZCTEOSA-N |
| XLogP | 2.59 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|