C14H16N4O5 — CID 167915084
1-hydroxy-N-[6-(2-methylpropoxy)-3-pyridinyl]-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 167915084) has the molecular formula C14H16N4O5 and a molecular weight of 320.31 g/mol. Its IUPAC name is 1-hydroxy-N-[6-(2-methylpropoxy)-3-pyridinyl]-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | 1-hydroxy-N-[6-(2-methylpropoxy)-3-pyridinyl]-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 167915084 |
| Molecular Formula | C14H16N4O5 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-hydroxy-N-[6-(2-methylpropoxy)-3-pyridinyl]-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | CC(C)COc1ccc(NC(=O)c2cn(O)c(=O)[nH]c2=O)cn1 |
| InChI | InChI=1S/C14H16N4O5/c1-8(2)7-23-11-4-3-9(5-15-11)16-12(19)10-6-18(22)14(21)17-13(10)20/h3-6,8,22H,7H2,1-2H3,(H,16,19)(H,17,20,21) |
| InChIKey | AGKZDXBHSUFKKH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|