C21H26N2O3 — CID 118762488
N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-4-(morpholine-4-carbonyl)benzamide (PubChem CID 118762488) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-4-(morpholine-4-carbonyl)benzamide.
| Compound Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-4-(morpholine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 118762488 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-4-(morpholine-4-carbonyl)benzamide |
| SMILES | O=C(NCC[C@@H]1C[C@@H]2C=C[C@H]1C2)c1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c24-20(22-8-7-19-14-15-1-2-18(19)13-15)16-3-5-17(6-4-16)21(25)23-9-11-26-12-10-23/h1-6,15,18-19H,7-14H2,(H,22,24)/t15-,18+,19-/m1/s1 |
| InChIKey | FSTORTAFYVFPQB-AYOQOUSVSA-N |
| XLogP | 2.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|