C17H21NO2 — CID 122034993
4-[[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]benzoic acid (PubChem CID 122034993) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122034993 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 4-[[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCCC2C[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C17H21NO2/c19-17(20)14-4-1-12(2-5-14)11-18-8-7-16-10-13-3-6-15(16)9-13/h1-6,13,15-16,18H,7-11H2,(H,19,20)/t13-,15+,16?/m1/s1 |
| InChIKey | MPZHNGVJHYBPOR-YISXUXMPSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|