C21H24F2N2O — CID 118762611
2-(2,3-difluorophenyl)-N-[2-(4-phenylpiperidin-1-yl)ethyl]acetamide (PubChem CID 118762611) has the molecular formula C21H24F2N2O and a molecular weight of 358.43 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-N-[2-(4-phenylpiperidin-1-yl)ethyl]acetamide.
| Compound Name | 2-(2,3-difluorophenyl)-N-[2-(4-phenylpiperidin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 118762611 |
| Molecular Formula | C21H24F2N2O |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-(2,3-difluorophenyl)-N-[2-(4-phenylpiperidin-1-yl)ethyl]acetamide |
| SMILES | O=C(Cc1cccc(F)c1F)NCCN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24F2N2O/c22-19-8-4-7-18(21(19)23)15-20(26)24-11-14-25-12-9-17(10-13-25)16-5-2-1-3-6-16/h1-8,17H,9-15H2,(H,24,26) |
| InChIKey | MDRYUVCDBVEASG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |