C22H28FN3O2 — CID 126443325
1-[(1R)-1-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-(4-phenylpiperidin-1-yl)ethyl]urea (PubChem CID 126443325) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-(4-phenylpiperidin-1-yl)ethyl]urea.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-(4-phenylpiperidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 126443325 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-(4-phenylpiperidin-1-yl)ethyl]urea |
| SMILES | O=C(NCCN1CCC(c2ccccc2)CC1)N[C@@H](CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H28FN3O2/c23-20-8-6-19(7-9-20)21(16-27)25-22(28)24-12-15-26-13-10-18(11-14-26)17-4-2-1-3-5-17/h1-9,18,21,27H,10-16H2,(H2,24,25,28)/t21-/m0/s1 |
| InChIKey | CTSGTTDNUVBNFI-NRFANRHFSA-N |
| XLogP | 3.04 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |