C17H22N4O3 — CID 118763523
(1S,9S)-12-[(2,3-dimethoxyphenyl)methyl]-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene (PubChem CID 118763523) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (1S,9S)-12-[(2,3-dimethoxyphenyl)methyl]-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene.
| Compound Name | (1S,9S)-12-[(2,3-dimethoxyphenyl)methyl]-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
|---|---|
| PubChem CID | 118763523 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (1S,9S)-12-[(2,3-dimethoxyphenyl)methyl]-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
| SMILES | COc1cccc(CN2CC[C@@H]3OCc4cnnn4[C@H]3C2)c1OC |
| InChI | InChI=1S/C17H22N4O3/c1-22-16-5-3-4-12(17(16)23-2)9-20-7-6-15-14(10-20)21-13(11-24-15)8-18-19-21/h3-5,8,14-15H,6-7,9-11H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | KXWGTLNPXAJKAG-GJZGRUSLSA-N |
| XLogP | 1.64 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |