C15H20N4O2 — CID 118781055
(1S,9S)-12-[3-(furan-2-yl)propyl]-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene (PubChem CID 118781055) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (1S,9S)-12-[3-(furan-2-yl)propyl]-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene.
| Compound Name | (1S,9S)-12-[3-(furan-2-yl)propyl]-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
|---|---|
| PubChem CID | 118781055 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (1S,9S)-12-[3-(furan-2-yl)propyl]-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
| SMILES | c1coc(CCCN2CC[C@@H]3OCc4cnnn4[C@H]3C2)c1 |
| InChI | InChI=1S/C15H20N4O2/c1(3-13-4-2-8-20-13)6-18-7-5-15-14(10-18)19-12(11-21-15)9-16-17-19/h2,4,8-9,14-15H,1,3,5-7,10-11H2/t14-,15-/m0/s1 |
| InChIKey | RMZNYHRRLMBWON-GJZGRUSLSA-N |
| XLogP | 1.65 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |