C19H25N5O2 — CID 118794381
N-[(4-methylphenyl)methyl]-3-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]propanamide (PubChem CID 118794381) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-3-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]propanamide.
| Compound Name | N-[(4-methylphenyl)methyl]-3-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]propanamide |
|---|---|
| PubChem CID | 118794381 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-3-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]propanamide |
| SMILES | Cc1ccc(CNC(=O)CCN2CC[C@@H]3OCc4cnnn4[C@H]3C2)cc1 |
| InChI | InChI=1S/C19H25N5O2/c1-14-2-4-15(5-3-14)10-20-19(25)7-9-23-8-6-18-17(12-23)24-16(13-26-18)11-21-22-24/h2-5,11,17-18H,6-10,12-13H2,1H3,(H,20,25)/t17-,18-/m0/s1 |
| InChIKey | ZYRGIZFQHSOZDK-ROUUACIJSA-N |
| XLogP | 1.44 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |