C18H22N6O3 — CID 118763560
1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-2-[3-(tetrazol-1-yl)phenoxy]ethanone (PubChem CID 118763560) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-2-[3-(tetrazol-1-yl)phenoxy]ethanone.
| Compound Name | 1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-2-[3-(tetrazol-1-yl)phenoxy]ethanone |
|---|---|
| PubChem CID | 118763560 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-2-[3-(tetrazol-1-yl)phenoxy]ethanone |
| SMILES | O=C(COc1cccc(-n2cnnn2)c1)N1CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C18H22N6O3/c25-17(22-7-9-23(10-8-22)18(26)14-3-1-4-14)12-27-16-6-2-5-15(11-16)24-13-19-20-21-24/h2,5-6,11,13-14H,1,3-4,7-10,12H2 |
| InChIKey | QFEULSQXPLPHMG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |