C16H22N6O2S — CID 118767728
1-[4-(2-methylsulfanylethyl)piperazin-1-yl]-2-[3-(tetrazol-1-yl)phenoxy]ethanone (PubChem CID 118767728) has the molecular formula C16H22N6O2S and a molecular weight of 362.46 g/mol. Its IUPAC name is 1-[4-(2-methylsulfanylethyl)piperazin-1-yl]-2-[3-(tetrazol-1-yl)phenoxy]ethanone.
| Compound Name | 1-[4-(2-methylsulfanylethyl)piperazin-1-yl]-2-[3-(tetrazol-1-yl)phenoxy]ethanone |
|---|---|
| PubChem CID | 118767728 |
| Molecular Formula | C16H22N6O2S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-[4-(2-methylsulfanylethyl)piperazin-1-yl]-2-[3-(tetrazol-1-yl)phenoxy]ethanone |
| SMILES | CSCCN1CCN(C(=O)COc2cccc(-n3cnnn3)c2)CC1 |
| InChI | InChI=1S/C16H22N6O2S/c1-25-10-9-20-5-7-21(8-6-20)16(23)12-24-15-4-2-3-14(11-15)22-13-17-18-19-22/h2-4,11,13H,5-10,12H2,1H3 |
| InChIKey | XCRLRCJMRBSXPA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |