C25H36NO3+ — CID 11876405
[(3S,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium (PubChem CID 11876405) has the molecular formula C25H36NO3+ and a molecular weight of 398.57 g/mol. Its IUPAC name is [(3S,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium.
| Compound Name | [(3S,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 11876405 |
| Molecular Formula | C25H36NO3+ |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | [(3S,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](C[NH+](C)[C@H](C)[C@@H](O)c4ccccc4)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C25H35NO3/c1-16-9-8-12-25(3)14-22-19(13-21(16)25)20(24(28)29-22)15-26(4)17(2)23(27)18-10-6-5-7-11-18/h5-7,10-11,17,19-23,27H,1,8-9,12-15H2,2-4H3/p+1/t17-,19-,20-,21+,22-,23-,25-/m1/s1 |
| InChIKey | RNTVEMBMXUXGLJ-ROOUNICHSA-O |
| XLogP | 2.94 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|