C15H23N5O4S — CID 118765190
N-[2-(dimethylsulfamoyl)ethyl]-3-(piperidine-1-carbonyl)pyrazine-2-carboxamide (PubChem CID 118765190) has the molecular formula C15H23N5O4S and a molecular weight of 369.45 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-3-(piperidine-1-carbonyl)pyrazine-2-carboxamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-3-(piperidine-1-carbonyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118765190 |
| Molecular Formula | C15H23N5O4S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-3-(piperidine-1-carbonyl)pyrazine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)c1nccnc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H23N5O4S/c1-19(2)25(23,24)11-8-18-14(21)12-13(17-7-6-16-12)15(22)20-9-4-3-5-10-20/h6-7H,3-5,8-11H2,1-2H3,(H,18,21) |
| InChIKey | HQSBUZRHIUUIIQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |