C14H23N3O5S — CID 74245817
N-[2-(dimethylsulfamoyl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide (PubChem CID 74245817) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 74245817 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)c1coc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C14H23N3O5S/c1-16(2)23(19,20)8-3-15-14(18)12-9-13(22-11-12)10-17-4-6-21-7-5-17/h9,11H,3-8,10H2,1-2H3,(H,15,18) |
| InChIKey | ICKPSTYMKHSJSD-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |