C18H24N4O3 — CID 72885838
N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide (PubChem CID 72885838) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide.
| Compound Name | N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 72885838 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide |
| SMILES | Cc1cccnc1NCCNC(=O)c1coc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C18H24N4O3/c1-14-3-2-4-19-17(14)20-5-6-21-18(23)15-11-16(25-13-15)12-22-7-9-24-10-8-22/h2-4,11,13H,5-10,12H2,1H3,(H,19,20)(H,21,23) |
| InChIKey | MRXDFDDQZLJGIS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|