C18H21N5O — CID 118766067
1-cyclopropyl-3-(1-ethylpyrazol-4-yl)-1-(1H-indol-5-ylmethyl)urea (PubChem CID 118766067) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1-ethylpyrazol-4-yl)-1-(1H-indol-5-ylmethyl)urea.
| Compound Name | 1-cyclopropyl-3-(1-ethylpyrazol-4-yl)-1-(1H-indol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 118766067 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-cyclopropyl-3-(1-ethylpyrazol-4-yl)-1-(1H-indol-5-ylmethyl)urea |
| SMILES | CCn1cc(NC(=O)N(Cc2ccc3[nH]ccc3c2)C2CC2)cn1 |
| InChI | InChI=1S/C18H21N5O/c1-2-22-12-15(10-20-22)21-18(24)23(16-4-5-16)11-13-3-6-17-14(9-13)7-8-19-17/h3,6-10,12,16,19H,2,4-5,11H2,1H3,(H,21,24) |
| InChIKey | RXOUXDYDVAMBBF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |