C20H25N3O2 — CID 118789700
N-cyclopropyl-N-(1H-indol-5-ylmethyl)-2-(2-oxoazepan-1-yl)acetamide (PubChem CID 118789700) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-cyclopropyl-N-(1H-indol-5-ylmethyl)-2-(2-oxoazepan-1-yl)acetamide.
| Compound Name | N-cyclopropyl-N-(1H-indol-5-ylmethyl)-2-(2-oxoazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 118789700 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-cyclopropyl-N-(1H-indol-5-ylmethyl)-2-(2-oxoazepan-1-yl)acetamide |
| SMILES | O=C1CCCCCN1CC(=O)N(Cc1ccc2[nH]ccc2c1)C1CC1 |
| InChI | InChI=1S/C20H25N3O2/c24-19-4-2-1-3-11-22(19)14-20(25)23(17-6-7-17)13-15-5-8-18-16(12-15)9-10-21-18/h5,8-10,12,17,21H,1-4,6-7,11,13-14H2 |
| InChIKey | WLRPNVZYFOAXRJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |