C21H28N2O5 — CID 55401551
[2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 55401551) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 55401551 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | COc1ccc(CN(C(=O)COC(=O)CN2CCCCCC2=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H28N2O5/c1-27-18-10-6-16(7-11-18)13-23(17-8-9-17)20(25)15-28-21(26)14-22-12-4-2-3-5-19(22)24/h6-7,10-11,17H,2-5,8-9,12-15H2,1H3 |
| InChIKey | ZLNNKBGSABZZKC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |