C20H27N3O2 — CID 122562050
1-cyclopropyl-3-[2-(1-hydroxycyclopentyl)ethyl]-1-(1H-indol-5-ylmethyl)urea (PubChem CID 122562050) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(1-hydroxycyclopentyl)ethyl]-1-(1H-indol-5-ylmethyl)urea.
| Compound Name | 1-cyclopropyl-3-[2-(1-hydroxycyclopentyl)ethyl]-1-(1H-indol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 122562050 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-cyclopropyl-3-[2-(1-hydroxycyclopentyl)ethyl]-1-(1H-indol-5-ylmethyl)urea |
| SMILES | O=C(NCCC1(O)CCCC1)N(Cc1ccc2[nH]ccc2c1)C1CC1 |
| InChI | InChI=1S/C20H27N3O2/c24-19(22-12-10-20(25)8-1-2-9-20)23(17-4-5-17)14-15-3-6-18-16(13-15)7-11-21-18/h3,6-7,11,13,17,21,25H,1-2,4-5,8-10,12,14H2,(H,22,24) |
| InChIKey | HSTABGLQAZJUAX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |