C28H27NO — CID 11876703
(2R,3R,5S,6R)-9-benzyl-2,6-diphenyl-9-azadispiro[2.1.25.33]decan-4-one (PubChem CID 11876703) has the molecular formula C28H27NO and a molecular weight of 393.53 g/mol. Its IUPAC name is (2R,3R,5S,6R)-9-benzyl-2,6-diphenyl-9-azadispiro[2.1.25.33]decan-4-one.
| Compound Name | (2R,3R,5S,6R)-9-benzyl-2,6-diphenyl-9-azadispiro[2.1.25.33]decan-4-one |
|---|---|
| PubChem CID | 11876703 |
| Molecular Formula | C28H27NO |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (2R,3R,5S,6R)-9-benzyl-2,6-diphenyl-9-azadispiro[2.1.25.33]decan-4-one |
| SMILES | O=C1[C@]2(C[C@@H]2c2ccccc2)CN(Cc2ccccc2)C[C@]12C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C28H27NO/c30-26-27(16-24(27)22-12-6-2-7-13-22)19-29(18-21-10-4-1-5-11-21)20-28(26)17-25(28)23-14-8-3-9-15-23/h1-15,24-25H,16-20H2/t24-,25-,27-,28+/m1/s1 |
| InChIKey | MXOGLMLNAHOAEG-KECVVUEUSA-N |
| XLogP | 5.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |