C15H21ClN2O2S — CID 118767630
2-(4-chlorophenyl)-2-hydroxy-1-[4-(2-methylsulfanylethyl)piperazin-1-yl]ethanone (PubChem CID 118767630) has the molecular formula C15H21ClN2O2S and a molecular weight of 328.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-hydroxy-1-[4-(2-methylsulfanylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-2-hydroxy-1-[4-(2-methylsulfanylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 118767630 |
| Molecular Formula | C15H21ClN2O2S |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-(4-chlorophenyl)-2-hydroxy-1-[4-(2-methylsulfanylethyl)piperazin-1-yl]ethanone |
| SMILES | CSCCN1CCN(C(=O)C(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H21ClN2O2S/c1-21-11-10-17-6-8-18(9-7-17)15(20)14(19)12-2-4-13(16)5-3-12/h2-5,14,19H,6-11H2,1H3 |
| InChIKey | HOGKPZBAGVWAKY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |