C12H18ClN3O4S — CID 118768412
1-(3-chloro-4-methoxyphenyl)-3-[2-[methyl(methylsulfonyl)amino]ethyl]urea (PubChem CID 118768412) has the molecular formula C12H18ClN3O4S and a molecular weight of 335.81 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[2-[methyl(methylsulfonyl)amino]ethyl]urea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[2-[methyl(methylsulfonyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 118768412 |
| Molecular Formula | C12H18ClN3O4S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[2-[methyl(methylsulfonyl)amino]ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCN(C)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C12H18ClN3O4S/c1-16(21(3,18)19)7-6-14-12(17)15-9-4-5-11(20-2)10(13)8-9/h4-5,8H,6-7H2,1-3H3,(H2,14,15,17) |
| InChIKey | DLVJDRNLYPAJOF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |