C17H23N5O4 — CID 118769002
(1R,5S,6R,7S)-N-[2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]-3-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 118769002) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (1R,5S,6R,7S)-N-[2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]-3-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1R,5S,6R,7S)-N-[2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]-3-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 118769002 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (1R,5S,6R,7S)-N-[2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]-3-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | COCCn1cnnc1CCNC(=O)[C@H]1[C@@H]2C=C[C@@]3(CN(C)C(=O)[C@@H]13)O2 |
| InChI | InChI=1S/C17H23N5O4/c1-21-9-17-5-3-11(26-17)13(14(17)16(21)24)15(23)18-6-4-12-20-19-10-22(12)7-8-25-2/h3,5,10-11,13-14H,4,6-9H2,1-2H3,(H,18,23)/t11-,13-,14+,17-/m0/s1 |
| InChIKey | YHEAGNPYAMEDBQ-DPYKFYPSSA-N |
| XLogP | -1.00 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|