C16H17N5O3S — CID 118763719
(1R,5S,6R,7S)-3-methyl-N-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 118763719) has the molecular formula C16H17N5O3S and a molecular weight of 359.41 g/mol. Its IUPAC name is (1R,5S,6R,7S)-3-methyl-N-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1R,5S,6R,7S)-3-methyl-N-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 118763719 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (1R,5S,6R,7S)-3-methyl-N-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | Cc1nn2cc(CNC(=O)[C@H]3[C@@H]4C=C[C@@]5(CN(C)C(=O)[C@@H]35)O4)nc2s1 |
| InChI | InChI=1S/C16H17N5O3S/c1-8-19-21-6-9(18-15(21)25-8)5-17-13(22)11-10-3-4-16(24-10)7-20(2)14(23)12(11)16/h3-4,6,10-12H,5,7H2,1-2H3,(H,17,22)/t10-,11-,12+,16-/m0/s1 |
| InChIKey | MKBMFXLWPBFWJH-OVZMXSCWSA-N |
| XLogP | 0.13 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|