C17H21N3O3S — CID 118785436
(1R,5S,6R,7S)-N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-3-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 118785436) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is (1R,5S,6R,7S)-N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-3-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1R,5S,6R,7S)-N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-3-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 118785436 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (1R,5S,6R,7S)-N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-3-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | Cc1nc(CCNC(=O)[C@H]2[C@@H]3C=C[C@@]4(CN(C)C(=O)[C@@H]24)O3)sc1C |
| InChI | InChI=1S/C17H21N3O3S/c1-9-10(2)24-12(19-9)5-7-18-15(21)13-11-4-6-17(23-11)8-20(3)16(22)14(13)17/h4,6,11,13-14H,5,7-8H2,1-3H3,(H,18,21)/t11-,13-,14+,17-/m0/s1 |
| InChIKey | YNUQNHMNVSVSCG-DPYKFYPSSA-N |
| XLogP | 0.83 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|