C23H36NO5+ — CID 11876907
ethyl (3S)-1-[[(3S,3aR,4aR,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl]piperidin-1-ium-3-carboxylate (PubChem CID 11876907) has the molecular formula C23H36NO5+ and a molecular weight of 406.54 g/mol. Its IUPAC name is ethyl (3S)-1-[[(3S,3aR,4aR,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[[(3S,3aR,4aR,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 11876907 |
| Molecular Formula | C23H36NO5+ |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | ethyl (3S)-1-[[(3S,3aR,4aR,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](C[C@H]2C(=O)O[C@@H]3C[C@@]4(C)CCC[C@@]5(CO5)[C@@H]4C[C@@H]32)C1 |
| InChI | InChI=1S/C23H35NO5/c1-3-27-20(25)15-6-4-9-24(12-15)13-17-16-10-19-22(2,11-18(16)29-21(17)26)7-5-8-23(19)14-28-23/h15-19H,3-14H2,1-2H3/p+1/t15-,16+,17+,18+,19+,22+,23+/m0/s1 |
| InChIKey | MRCZGRKLFRRWMY-REVDCZTESA-O |
| XLogP | 1.37 |
| TPSA | 69.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|