C19H32NO5+ — CID 11876789
[(3S,3aR,4aS,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-(2,2-dimethoxyethyl)azanium (PubChem CID 11876789) has the molecular formula C19H32NO5+ and a molecular weight of 354.47 g/mol. Its IUPAC name is [(3S,3aR,4aS,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-(2,2-dimethoxyethyl)azanium.
| Compound Name | [(3S,3aR,4aS,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-(2,2-dimethoxyethyl)azanium |
|---|---|
| PubChem CID | 11876789 |
| Molecular Formula | C19H32NO5+ |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | [(3S,3aR,4aS,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-(2,2-dimethoxyethyl)azanium |
| SMILES | COC(C[NH2+]C[C@H]1C(=O)O[C@@H]2C[C@@]3(C)CCC[C@@]4(CO4)[C@H]3C[C@@H]21)OC |
| InChI | InChI=1S/C19H31NO5/c1-18-5-4-6-19(11-24-19)15(18)7-12-13(17(21)25-14(12)8-18)9-20-10-16(22-2)23-3/h12-16,20H,4-11H2,1-3H3/p+1/t12-,13-,14-,15+,18-,19-/m1/s1 |
| InChIKey | QYBZORASFQWCSU-SQJBMSRPSA-O |
| XLogP | 0.70 |
| TPSA | 73.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|