C23H34NO4+ — CID 11875790
[(3S,3aR,4aR,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-[(2R)-4-(furan-2-yl)butan-2-yl]azanium (PubChem CID 11875790) has the molecular formula C23H34NO4+ and a molecular weight of 388.53 g/mol. Its IUPAC name is [(3S,3aR,4aR,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-[(2R)-4-(furan-2-yl)butan-2-yl]azanium.
| Compound Name | [(3S,3aR,4aR,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-[(2R)-4-(furan-2-yl)butan-2-yl]azanium |
|---|---|
| PubChem CID | 11875790 |
| Molecular Formula | C23H34NO4+ |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [(3S,3aR,4aR,5S,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-[(2R)-4-(furan-2-yl)butan-2-yl]azanium |
| SMILES | C[C@H](CCc1ccco1)[NH2+]C[C@H]1C(=O)O[C@@H]2C[C@@]3(C)CCC[C@@]4(CO4)[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C23H33NO4/c1-15(6-7-16-5-3-10-26-16)24-13-18-17-11-20-22(2,12-19(17)28-21(18)25)8-4-9-23(20)14-27-23/h3,5,10,15,17-20,24H,4,6-9,11-14H2,1-2H3/p+1/t15-,17-,18-,19-,20-,22-,23-/m1/s1 |
| InChIKey | SSCYZNWHTIRQSX-FEWBRLDPSA-O |
| XLogP | 2.69 |
| TPSA | 68.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|