C23H31FNO3+ — CID 11873814
[(3S,3aR,4aR,5R,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-[2-(4-fluorophenyl)ethyl]azanium (PubChem CID 11873814) has the molecular formula C23H31FNO3+ and a molecular weight of 388.50 g/mol. Its IUPAC name is [(3S,3aR,4aR,5R,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-[2-(4-fluorophenyl)ethyl]azanium.
| Compound Name | [(3S,3aR,4aR,5R,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-[2-(4-fluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 11873814 |
| Molecular Formula | C23H31FNO3+ |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | [(3S,3aR,4aR,5R,8aR,9aR)-8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl]methyl-[2-(4-fluorophenyl)ethyl]azanium |
| SMILES | C[C@]12CCC[C@]3(CO3)[C@@H]1C[C@H]1[C@@H](C2)OC(=O)[C@@H]1C[NH2+]CCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H30FNO3/c1-22-8-2-9-23(14-27-23)20(22)11-17-18(21(26)28-19(17)12-22)13-25-10-7-15-3-5-16(24)6-4-15/h3-6,17-20,25H,2,7-14H2,1H3/p+1/t17-,18-,19-,20-,22-,23+/m1/s1 |
| InChIKey | MMPZDIHKVXWPMI-XPRTXTSQSA-O |
| XLogP | 2.46 |
| TPSA | 55.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|