C23H31NO4 — CID 163082193
(3S,3aS,4aS,5S,8aR,9aR)-3-[[(2-methoxyphenyl)methylamino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 163082193) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is (3S,3aS,4aS,5S,8aR,9aR)-3-[[(2-methoxyphenyl)methylamino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | (3S,3aS,4aS,5S,8aR,9aR)-3-[[(2-methoxyphenyl)methylamino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 163082193 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (3S,3aS,4aS,5S,8aR,9aR)-3-[[(2-methoxyphenyl)methylamino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | COc1ccccc1CNC[C@H]1C(=O)O[C@@H]2C[C@@]3(C)CCC[C@@]4(CO4)[C@H]3C[C@H]21 |
| InChI | InChI=1S/C23H31NO4/c1-22-8-5-9-23(14-27-23)20(22)10-16-17(21(25)28-19(16)11-22)13-24-12-15-6-3-4-7-18(15)26-2/h3-4,6-7,16-17,19-20,24H,5,8-14H2,1-2H3/t16-,17+,19+,20-,22+,23+/m0/s1 |
| InChIKey | AQSSCMNLIVYIHH-QIFKQXTKSA-N |
| XLogP | 3.31 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|