C27H39NO6 — CID 163078178
(3R,3aS,4aR,5R,8aR,9aR)-3-[[(3,4-dimethoxyphenyl)methyl-(3-hydroxypropyl)amino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 163078178) has the molecular formula C27H39NO6 and a molecular weight of 473.61 g/mol. Its IUPAC name is (3R,3aS,4aR,5R,8aR,9aR)-3-[[(3,4-dimethoxyphenyl)methyl-(3-hydroxypropyl)amino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | (3R,3aS,4aR,5R,8aR,9aR)-3-[[(3,4-dimethoxyphenyl)methyl-(3-hydroxypropyl)amino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 163078178 |
| Molecular Formula | C27H39NO6 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | (3R,3aS,4aR,5R,8aR,9aR)-3-[[(3,4-dimethoxyphenyl)methyl-(3-hydroxypropyl)amino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | COc1ccc(CN(CCCO)C[C@@H]2C(=O)O[C@@H]3C[C@@]4(C)CCC[C@]5(CO5)[C@@H]4C[C@@H]23)cc1OC |
| InChI | InChI=1S/C27H39NO6/c1-26-8-4-9-27(17-33-27)24(26)13-19-20(25(30)34-23(19)14-26)16-28(10-5-11-29)15-18-6-7-21(31-2)22(12-18)32-3/h6-7,12,19-20,23-24,29H,4-5,8-11,13-17H2,1-3H3/t19-,20-,23+,24+,26+,27-/m0/s1 |
| InChIKey | ODXRMYXJGOGYEL-NHSSYGHSSA-N |
| XLogP | 3.42 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|