C28H35NO5 — CID 163077932
(3R,3aS,4aR,5R,8aR,9aR)-3-[[furan-2-ylmethyl-[(4-methoxyphenyl)methyl]amino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 163077932) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is (3R,3aS,4aR,5R,8aR,9aR)-3-[[furan-2-ylmethyl-[(4-methoxyphenyl)methyl]amino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | (3R,3aS,4aR,5R,8aR,9aR)-3-[[furan-2-ylmethyl-[(4-methoxyphenyl)methyl]amino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 163077932 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (3R,3aS,4aR,5R,8aR,9aR)-3-[[furan-2-ylmethyl-[(4-methoxyphenyl)methyl]amino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | COc1ccc(CN(Cc2ccco2)C[C@@H]2C(=O)O[C@@H]3C[C@@]4(C)CCC[C@]5(CO5)[C@@H]4C[C@@H]23)cc1 |
| InChI | InChI=1S/C28H35NO5/c1-27-10-4-11-28(18-33-28)25(27)13-22-23(26(30)34-24(22)14-27)17-29(16-21-5-3-12-32-21)15-19-6-8-20(31-2)9-7-19/h3,5-9,12,22-25H,4,10-11,13-18H2,1-2H3/t22-,23-,24+,25+,27+,28-/m0/s1 |
| InChIKey | ZBOSXLVPZSYSOY-SGBNRSCDSA-N |
| XLogP | 4.82 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|