C24H35NO4 — CID 11876609
(3S,3aR,4aR,5S,8aR,9aR)-3-[[[(2R)-4-(furan-2-yl)butan-2-yl]-methylamino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 11876609) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is (3S,3aR,4aR,5S,8aR,9aR)-3-[[[(2R)-4-(furan-2-yl)butan-2-yl]-methylamino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | (3S,3aR,4aR,5S,8aR,9aR)-3-[[[(2R)-4-(furan-2-yl)butan-2-yl]-methylamino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 11876609 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | (3S,3aR,4aR,5S,8aR,9aR)-3-[[[(2R)-4-(furan-2-yl)butan-2-yl]-methylamino]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | C[C@H](CCc1ccco1)N(C)C[C@H]1C(=O)O[C@@H]2C[C@@]3(C)CCC[C@@]4(CO4)[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C24H35NO4/c1-16(7-8-17-6-4-11-27-17)25(3)14-19-18-12-21-23(2,13-20(18)29-22(19)26)9-5-10-24(21)15-28-24/h4,6,11,16,18-21H,5,7-10,12-15H2,1-3H3/t16-,18-,19-,20-,21-,23-,24-/m1/s1 |
| InChIKey | RFDZLHQISAXUIQ-XBNLDRLWSA-N |
| XLogP | 4.06 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|