C21H28N2O3 — CID 7069390
(3R,3aR,4aS,5R,8aR,9aR)-8a-methyl-3-[(pyridin-3-ylmethylamino)methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 7069390) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (3R,3aR,4aS,5R,8aR,9aR)-8a-methyl-3-[(pyridin-3-ylmethylamino)methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | (3R,3aR,4aS,5R,8aR,9aR)-8a-methyl-3-[(pyridin-3-ylmethylamino)methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 7069390 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (3R,3aR,4aS,5R,8aR,9aR)-8a-methyl-3-[(pyridin-3-ylmethylamino)methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | C[C@]12CCC[C@]3(CO3)[C@H]1C[C@@H]1[C@H](CNCc3cccnc3)C(=O)O[C@@H]1C2 |
| InChI | InChI=1S/C21H28N2O3/c1-20-5-3-6-21(13-25-21)18(20)8-15-16(19(24)26-17(15)9-20)12-23-11-14-4-2-7-22-10-14/h2,4,7,10,15-18,23H,3,5-6,8-9,11-13H2,1H3/t15-,16+,17-,18+,20-,21+/m1/s1 |
| InChIKey | VQWYYIOVDKGSML-OVDOOKCHSA-N |
| XLogP | 2.70 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|