C16H23FN4O3 — CID 118769740
3-[[2-fluoro-5-(propanoylamino)phenyl]carbamoyl-methylamino]-N-methylbutanamide (PubChem CID 118769740) has the molecular formula C16H23FN4O3 and a molecular weight of 338.38 g/mol. Its IUPAC name is 3-[[2-fluoro-5-(propanoylamino)phenyl]carbamoyl-methylamino]-N-methylbutanamide.
| Compound Name | 3-[[2-fluoro-5-(propanoylamino)phenyl]carbamoyl-methylamino]-N-methylbutanamide |
|---|---|
| PubChem CID | 118769740 |
| Molecular Formula | C16H23FN4O3 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 3-[[2-fluoro-5-(propanoylamino)phenyl]carbamoyl-methylamino]-N-methylbutanamide |
| SMILES | CCC(=O)Nc1ccc(F)c(NC(=O)N(C)C(C)CC(=O)NC)c1 |
| InChI | InChI=1S/C16H23FN4O3/c1-5-14(22)19-11-6-7-12(17)13(9-11)20-16(24)21(4)10(2)8-15(23)18-3/h6-7,9-10H,5,8H2,1-4H3,(H,18,23)(H,19,22)(H,20,24) |
| InChIKey | BQWMIHFUPIKDJH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |