C15H23N3O2S — CID 125177880
(3S)-3-[(2-ethylsulfanylphenyl)carbamoyl-methylamino]-N-methylbutanamide (PubChem CID 125177880) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (3S)-3-[(2-ethylsulfanylphenyl)carbamoyl-methylamino]-N-methylbutanamide.
| Compound Name | (3S)-3-[(2-ethylsulfanylphenyl)carbamoyl-methylamino]-N-methylbutanamide |
|---|---|
| PubChem CID | 125177880 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3S)-3-[(2-ethylsulfanylphenyl)carbamoyl-methylamino]-N-methylbutanamide |
| SMILES | CCSc1ccccc1NC(=O)N(C)[C@@H](C)CC(=O)NC |
| InChI | InChI=1S/C15H23N3O2S/c1-5-21-13-9-7-6-8-12(13)17-15(20)18(4)11(2)10-14(19)16-3/h6-9,11H,5,10H2,1-4H3,(H,16,19)(H,17,20)/t11-/m0/s1 |
| InChIKey | SVLPOGBIODTFFH-NSHDSACASA-N |
| XLogP | 2.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |