C19H19NO4 — CID 118770031
1-[2-hydroxy-5-[4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]phenyl]phenyl]ethanone (PubChem CID 118770031) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-[2-hydroxy-5-[4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]phenyl]phenyl]ethanone.
| Compound Name | 1-[2-hydroxy-5-[4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]phenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 118770031 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-[2-hydroxy-5-[4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]phenyl]phenyl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccc(C(=O)N3CC[C@@H](O)C3)cc2)ccc1O |
| InChI | InChI=1S/C19H19NO4/c1-12(21)17-10-15(6-7-18(17)23)13-2-4-14(5-3-13)19(24)20-9-8-16(22)11-20/h2-7,10,16,22-23H,8-9,11H2,1H3/t16-/m1/s1 |
| InChIKey | YVTLTQRXOXRFEP-MRXNPFEDSA-N |
| XLogP | 2.47 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |