C20H29N3OS — CID 118770415
1-[4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-2-(2-methylphenyl)sulfanylethanone (PubChem CID 118770415) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is 1-[4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-2-(2-methylphenyl)sulfanylethanone.
| Compound Name | 1-[4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-2-(2-methylphenyl)sulfanylethanone |
|---|---|
| PubChem CID | 118770415 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[4-(1-azabicyclo[2.2.2]octan-3-yl)piperazin-1-yl]-2-(2-methylphenyl)sulfanylethanone |
| SMILES | Cc1ccccc1SCC(=O)N1CCN(C2CN3CCC2CC3)CC1 |
| InChI | InChI=1S/C20H29N3OS/c1-16-4-2-3-5-19(16)25-15-20(24)23-12-10-22(11-13-23)18-14-21-8-6-17(18)7-9-21/h2-5,17-18H,6-15H2,1H3 |
| InChIKey | CUUAUJSPVHLGCO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |