C16H21FN6O — CID 118770949
N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]-3-(5-methyltetrazol-1-yl)propanamide (PubChem CID 118770949) has the molecular formula C16H21FN6O and a molecular weight of 332.38 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]-3-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]-3-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 118770949 |
| Molecular Formula | C16H21FN6O |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]-3-(5-methyltetrazol-1-yl)propanamide |
| SMILES | Cc1nnnn1CCC(=O)NCC1CCN(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H21FN6O/c1-12-19-20-21-23(12)9-7-16(24)18-10-13-6-8-22(11-13)15-4-2-14(17)3-5-15/h2-5,13H,6-11H2,1H3,(H,18,24) |
| InChIKey | GIROSQQQQSUTQG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |